Compound Q&A

What are the physical and chemical properties of (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5)?

Answer

(3-Cyanophenyl)methanesulfonyl chloride
(3-Cyanophenyl)methanesulfonyl chloride is a white to off-white crystalline solid with a molecular weight of approximately 248.18 g/mol. It has a low solubility in water but is more soluble in organic solvents like dichloromethane and acetone. Chemically, it is highly reactive, particularly due to the presence of the electrophilic sulfonyl chloride group, which readily undergoes nucleophilic substitution reactions.

About

CAS No 56106-01-5
English Name (3-Cyanophenyl)methanesulfonyl chloride
Molecular Formula C8H6ClNO2S
Molecular Weight 215.66 g/mol
SMILES C1=CC(=CC(=C1)C#N)CS(=O)(=O)Cl
InChIKey YNWYDZBBHOWDAE-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5) typically synthesized?

(3-Cyanophenyl)methanesulfonyl chloride is usually synthesized by the reaction of 3-cyanophenylmetha...

Compound Q&A

What industries use (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5)?

(3-Cyanophenyl)methanesulfonyl chloride is used in various industries, particularly in pharmaceutica...

Compound Q&A

What precautions should be taken when handling (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5)?

Proper handling of (3-Cyanophenyl)methanesulfonyl chloride requires the use of personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...