Compound Q&A

What precautions should be taken when handling (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8)?

Answer

(S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid
When handling (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8), it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Always work in a well-ventilated area or fume hood to minimize inhalation risks. Spills should be managed carefully using appropriate absorbent materials. Refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions to ensure safe laboratory practices.

About

CAS No 3978-11-8
English Name (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid
Molecular Formula C11H12N2O4
Molecular Weight 236.23 g/mol
SMILES C1=CC=C(C(=C1)C(=O)CC(C(=O)O)N)NC=O
InChIKey BYHJHXPTQMMKCA-QMMMGPOBSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8)?

(S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8) is a crystalline compound with...

Compound Q&A

How is (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8) typically synthesized?

(S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8) can be synthesized through the...

Compound Q&A

What industries use (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8)?

(S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8) finds applications in the phar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...