Compound Q&A

What industries use (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8)?

Answer

(S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid
(S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8) finds applications in the pharmaceutical industry for the synthesis of chiral compounds and as a building block in drug development. It is also used in polymer synthesis, where its chiral nature can influence the properties of polymers. Additionally, it has potential uses in sensor technologies and semiconductor manufacturing due to its unique reactivity and structural properties.

About

CAS No 3978-11-8
English Name (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid
Molecular Formula C11H12N2O4
Molecular Weight 236.23 g/mol
SMILES C1=CC=C(C(=C1)C(=O)CC(C(=O)O)N)NC=O
InChIKey BYHJHXPTQMMKCA-QMMMGPOBSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8)?

(S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8) is a crystalline compound with...

Compound Q&A

How is (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8) typically synthesized?

(S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8) can be synthesized through the...

Compound Q&A

What precautions should be taken when handling (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8)?

When handling (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...