Compound Q&A

What are the physical and chemical properties of (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8)?

Answer

(S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid
(S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8) is a crystalline compound with a molecular weight of approximately 212.2 g/mol. It is slightly soluble in water and very soluble in organic solvents. It exhibits moderate reactivity, especially under basic conditions, and can undergo condensation reactions. The compound is stable under normal conditions but should be stored away from strong acids and bases to prevent degradation.

About

CAS No 3978-11-8
English Name (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid
Molecular Formula C11H12N2O4
Molecular Weight 236.23 g/mol
SMILES C1=CC=C(C(=C1)C(=O)CC(C(=O)O)N)NC=O
InChIKey BYHJHXPTQMMKCA-QMMMGPOBSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8) typically synthesized?

(S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8) can be synthesized through the...

Compound Q&A

What industries use (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8)?

(S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8) finds applications in the phar...

Compound Q&A

What precautions should be taken when handling (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8)?

When handling (S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid (CAS: 3978-11-8), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...