Compound Q&A

What precautions should be taken when handling 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3)?

Answer

2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine
When handling 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3), it is essential to work in a well-ventilated area or a fume hood. Wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Spills should be carefully cleaned up using appropriate chemical spill kits. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine
Molecular Formula C13H13Cl2N3S
Molecular Weight 314.24 g/mol
SMILES CC(C)Sc1ccccc1Nc2c(cnc(n2)Cl)Cl
InChIKey XBNWAVDIFJHCOK-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3)?

2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3) is a solid with a ...

Compound Q&A

How is 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3) typically synthesized?

2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine is typically synthesized via a multist...

Compound Q&A

What industries use 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3)?

2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3) is primarily used ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...