Compound Q&A

What are the physical and chemical properties of 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3)?

Answer

2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine
2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3) is a solid with a molecular weight of approximately 357.06 g/mol. It has a crystalline form and a high melting point, around 200°C. It is slightly soluble in water but soluble in organic solvents like DMSO and DMF. This compound is reactive towards nucleophiles and shows potential for substitution reactions.

About

English Name 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine
Molecular Formula C13H13Cl2N3S
Molecular Weight 314.24 g/mol
SMILES CC(C)Sc1ccccc1Nc2c(cnc(n2)Cl)Cl
InChIKey XBNWAVDIFJHCOK-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3) typically synthesized?

2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine is typically synthesized via a multist...

Compound Q&A

What industries use 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3)?

2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3) is primarily used ...

Compound Q&A

What precautions should be taken when handling 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3)?

When handling 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3), it ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...