Compound Q&A

What industries use 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3)?

Answer

2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine
2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3) is primarily used in the pharmaceutical industry for the development of new drugs, particularly in antiviral and anticancer drug research. It may also find applications in the sensor and semiconductor industries due to its specific chemical functionality.

About

English Name 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine
Molecular Formula C13H13Cl2N3S
Molecular Weight 314.24 g/mol
SMILES CC(C)Sc1ccccc1Nc2c(cnc(n2)Cl)Cl
InChIKey XBNWAVDIFJHCOK-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3)?

2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3) is a solid with a ...

Compound Q&A

How is 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3) typically synthesized?

2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine is typically synthesized via a multist...

Compound Q&A

What precautions should be taken when handling 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3)?

When handling 2,5-Dichloro-N-[2-(isopropylsulfanyl)phenyl]-4-pyrimidinamine (CAS: 1632485-14-3), it ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...