Compound Q&A

What precautions should be taken when handling delta-2-Ceftazidime (CAS: 1000980-60-8)?

Answer

delta-2-Ceftazidime
When handling delta-2-Ceftazidime (CAS: 1000980-60-8), it is essential to use proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to minimize inhalation risk. Spills should be cleaned up using appropriate absorbents, and the area should be thoroughly decontaminated. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

English Name delta-2-Ceftazidime
Molecular Formula C22H22N6O7S2
Molecular Weight 546.58 g/mol
SMILES CC(C)(C(=O)O)ON=C(C1=CSC(=N1)N)C(=O)NC2C3N(C2=O)C(C(=CS3)C[N+]4=CC=CC=C4)C(=O)[O-]
InChIKey LRKHKETXQNDOKF-YTAHGSIGSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of delta-2-Ceftazidime (CAS: 1000980-60-8)?

Delta-2-Ceftazidime (CAS: 1000980-60-8) is a crystalline antibiotic with a molecular weight of appro...

Compound Q&A

How is delta-2-Ceftazidime (CAS: 1000980-60-8) typically synthesized?

Delta-2-Ceftazidime is typically synthesized via a multi-step process involving the acetylation of a...

Compound Q&A

What industries use delta-2-Ceftazidime (CAS: 1000980-60-8)?

Delta-2-Ceftazidime (CAS: 1000980-60-8) is primarily used in the pharmaceutical industry for the tre...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...