Compound Q&A

What are the physical and chemical properties of delta-2-Ceftazidime (CAS: 1000980-60-8)?

Answer

delta-2-Ceftazidime
Delta-2-Ceftazidime (CAS: 1000980-60-8) is a crystalline antibiotic with a molecular weight of approximately 622.75 g/mol. It is slightly soluble in water and has good solubility in organic solvents. The compound exhibits good reactivity towards hydrolysis under basic conditions. Its chemical stability is maintained under neutral and slightly acidic pH conditions.

About

English Name delta-2-Ceftazidime
Molecular Formula C22H22N6O7S2
Molecular Weight 546.58 g/mol
SMILES CC(C)(C(=O)O)ON=C(C1=CSC(=N1)N)C(=O)NC2C3N(C2=O)C(C(=CS3)C[N+]4=CC=CC=C4)C(=O)[O-]
InChIKey LRKHKETXQNDOKF-YTAHGSIGSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

How is delta-2-Ceftazidime (CAS: 1000980-60-8) typically synthesized?

Delta-2-Ceftazidime is typically synthesized via a multi-step process involving the acetylation of a...

Compound Q&A

What industries use delta-2-Ceftazidime (CAS: 1000980-60-8)?

Delta-2-Ceftazidime (CAS: 1000980-60-8) is primarily used in the pharmaceutical industry for the tre...

Compound Q&A

What precautions should be taken when handling delta-2-Ceftazidime (CAS: 1000980-60-8)?

When handling delta-2-Ceftazidime (CAS: 1000980-60-8), it is essential to use proper personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...