Compound Q&A

How is delta-2-Ceftazidime (CAS: 1000980-60-8) typically synthesized?

Answer

delta-2-Ceftazidime
Delta-2-Ceftazidime is typically synthesized via a multi-step process involving the acetylation of a cephalosporin nucleus, followed by ring opening and modification reactions. Commonly used catalysts include acid or base catalysts, and the reaction conditions are optimized for high selectivity and yield. The synthesis process requires precise control over reaction temperature and time.

About

English Name delta-2-Ceftazidime
Molecular Formula C22H22N6O7S2
Molecular Weight 546.58 g/mol
SMILES CC(C)(C(=O)O)ON=C(C1=CSC(=N1)N)C(=O)NC2C3N(C2=O)C(C(=CS3)C[N+]4=CC=CC=C4)C(=O)[O-]
InChIKey LRKHKETXQNDOKF-YTAHGSIGSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of delta-2-Ceftazidime (CAS: 1000980-60-8)?

Delta-2-Ceftazidime (CAS: 1000980-60-8) is a crystalline antibiotic with a molecular weight of appro...

Compound Q&A

What industries use delta-2-Ceftazidime (CAS: 1000980-60-8)?

Delta-2-Ceftazidime (CAS: 1000980-60-8) is primarily used in the pharmaceutical industry for the tre...

Compound Q&A

What precautions should be taken when handling delta-2-Ceftazidime (CAS: 1000980-60-8)?

When handling delta-2-Ceftazidime (CAS: 1000980-60-8), it is essential to use proper personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...