Compound Q&A

What industries use delta-2-Ceftazidime (CAS: 1000980-60-8)?

Answer

delta-2-Ceftazidime
Delta-2-Ceftazidime (CAS: 1000980-60-8) is primarily used in the pharmaceutical industry for the treatment of bacterial infections. It is also employed in the development of cephalosporin-based antimicrobial agents. Due to its broad-spectrum activity, it is often utilized in hospitals and clinics for various medical applications.

About

English Name delta-2-Ceftazidime
Molecular Formula C22H22N6O7S2
Molecular Weight 546.58 g/mol
SMILES CC(C)(C(=O)O)ON=C(C1=CSC(=N1)N)C(=O)NC2C3N(C2=O)C(C(=CS3)C[N+]4=CC=CC=C4)C(=O)[O-]
InChIKey LRKHKETXQNDOKF-YTAHGSIGSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of delta-2-Ceftazidime (CAS: 1000980-60-8)?

Delta-2-Ceftazidime (CAS: 1000980-60-8) is a crystalline antibiotic with a molecular weight of appro...

Compound Q&A

How is delta-2-Ceftazidime (CAS: 1000980-60-8) typically synthesized?

Delta-2-Ceftazidime is typically synthesized via a multi-step process involving the acetylation of a...

Compound Q&A

What precautions should be taken when handling delta-2-Ceftazidime (CAS: 1000980-60-8)?

When handling delta-2-Ceftazidime (CAS: 1000980-60-8), it is essential to use proper personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...