Compound Q&A

What precautions should be taken when handling [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3)?

Answer

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid
When handling [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid, it is essential to use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure to air. Spills should be cleaned up promptly using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed information and emergency procedures. The compound should be stored in a cool, dry place away from direct sunlight and incompatible materials.

About

English Name [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C10H12BF3O3
Molecular Weight 248.01 g/mol
SMILES B(C1=C(C=C(C=C1)OC(C)C)C(F)(F)F)(O)O
InChIKey MQWMPOPSYRZCAI-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3)?

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid is a white crystalline solid with a molecular w...

Compound Q&A

How is [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3) typically synthesized?

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid is typically synthesized via a coupling reactio...

Compound Q&A

What industries use [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3)?

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid is primarily used in the pharmaceutical industr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...