Compound Q&A

How is [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3) typically synthesized?

Answer

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid
[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid is typically synthesized via a coupling reaction between 4-isopropoxy-2-(trifluoromethyl)phenol and boronic acid derivatives using a catalyst such as palladium(II) acetate in the presence of a phase-transfer catalyst and a base like triphenylphosphine. This method yields high selectivity and good to excellent yield depending on the reaction conditions.

About

English Name [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C10H12BF3O3
Molecular Weight 248.01 g/mol
SMILES B(C1=C(C=C(C=C1)OC(C)C)C(F)(F)F)(O)O
InChIKey MQWMPOPSYRZCAI-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3)?

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid is a white crystalline solid with a molecular w...

Compound Q&A

What industries use [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3)?

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3)?

When handling [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid, it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...