Compound Q&A

What industries use [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3)?

Answer

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid
[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid is primarily used in the pharmaceutical industry for the synthesis of complex organic molecules, particularly in the field of medicinal chemistry. It is also utilized in the polymer industry for the development of new materials with specific properties. Additionally, it finds applications in the sensor technology and semiconductor manufacturing sectors due to its unique chemical functionality.

About

English Name [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C10H12BF3O3
Molecular Weight 248.01 g/mol
SMILES B(C1=C(C=C(C=C1)OC(C)C)C(F)(F)F)(O)O
InChIKey MQWMPOPSYRZCAI-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3)?

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid is a white crystalline solid with a molecular w...

Compound Q&A

How is [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3) typically synthesized?

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid is typically synthesized via a coupling reactio...

Compound Q&A

What precautions should be taken when handling [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3)?

When handling [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid, it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...