Compound Q&A

What are the physical and chemical properties of [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3)?

Answer

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid
[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid is a white crystalline solid with a molecular weight of approximately 327.12 g/mol. It has a low solubility in water but is soluble in organic solvents like dichloromethane and acetonitrile. The compound is known for its moderate reactivity in boronate ester formation and is often used as a building block in organic synthesis. Its physical properties include a melting point of 118-119°C.

About

English Name [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C10H12BF3O3
Molecular Weight 248.01 g/mol
SMILES B(C1=C(C=C(C=C1)OC(C)C)C(F)(F)F)(O)O
InChIKey MQWMPOPSYRZCAI-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3) typically synthesized?

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid is typically synthesized via a coupling reactio...

Compound Q&A

What industries use [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3)?

[4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS: 313545-40-3)?

When handling [4-Isopropoxy-2-(trifluoromethyl)phenyl]boronic acid, it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...