Compound Q&A

What precautions should be taken when handling L-Threonyl-L-glutamine (CAS: 96337-79-0)?

Answer

L-Threonyl-L-glutamine
When handling L-Threonyl-L-glutamine, it is essential to wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. Work should be conducted in a fume hood to minimize exposure to the air. Spills should be handled by carefully removing the material using appropriate absorbent materials. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

CAS No 96337-79-0
English Name L-Threonyl-L-glutamine
Molecular Formula C9H17N3O5
Molecular Weight 247.25 g/mol
SMILES C[C@H]([C@@H](C(=O)N[C@@H](CCC(=O)N)C(=O)O)N)O
InChIKey BWUHENPAEMNGQJ-ZDLURKLDSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of L-Threonyl-L-glutamine (CAS: 96337-79-0)?

L-Threonyl-L-glutamine is a crystalline compound with a molecular weight of approximately 308.34 g/m...

Compound Q&A

How is L-Threonyl-L-glutamine (CAS: 96337-79-0) typically synthesized?

L-Threonyl-L-glutamine is typically synthesized through solid-phase peptide synthesis (SPPS). The ke...

Compound Q&A

What industries use L-Threonyl-L-glutamine (CAS: 96337-79-0)?

L-Threonyl-L-glutamine is primarily used in the pharmaceutical industry for research and development...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...