Compound Q&A

What are the physical and chemical properties of L-Threonyl-L-glutamine (CAS: 96337-79-0)?

Answer

L-Threonyl-L-glutamine
L-Threonyl-L-glutamine is a crystalline compound with a molecular weight of approximately 308.34 g/mol. It is slightly soluble in water and exhibits good solubility in common organic solvents like ethanol. The compound is moderately reactive and can undergo hydrolysis under acidic conditions. It has a melting point of 195-197°C.

About

CAS No 96337-79-0
English Name L-Threonyl-L-glutamine
Molecular Formula C9H17N3O5
Molecular Weight 247.25 g/mol
SMILES C[C@H]([C@@H](C(=O)N[C@@H](CCC(=O)N)C(=O)O)N)O
InChIKey BWUHENPAEMNGQJ-ZDLURKLDSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

How is L-Threonyl-L-glutamine (CAS: 96337-79-0) typically synthesized?

L-Threonyl-L-glutamine is typically synthesized through solid-phase peptide synthesis (SPPS). The ke...

Compound Q&A

What industries use L-Threonyl-L-glutamine (CAS: 96337-79-0)?

L-Threonyl-L-glutamine is primarily used in the pharmaceutical industry for research and development...

Compound Q&A

What precautions should be taken when handling L-Threonyl-L-glutamine (CAS: 96337-79-0)?

When handling L-Threonyl-L-glutamine, it is essential to wear appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...