Compound Q&A

What industries use L-Threonyl-L-glutamine (CAS: 96337-79-0)?

Answer

L-Threonyl-L-glutamine
L-Threonyl-L-glutamine is primarily used in the pharmaceutical industry for research and development of therapeutic peptides. It is also utilized in polymer chemistry for the synthesis of functional polymers with specific properties. Additionally, it has potential applications in sensor technology and semiconductor manufacturing due to its reactivity and specific chemical functionality.

About

CAS No 96337-79-0
English Name L-Threonyl-L-glutamine
Molecular Formula C9H17N3O5
Molecular Weight 247.25 g/mol
SMILES C[C@H]([C@@H](C(=O)N[C@@H](CCC(=O)N)C(=O)O)N)O
InChIKey BWUHENPAEMNGQJ-ZDLURKLDSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of L-Threonyl-L-glutamine (CAS: 96337-79-0)?

L-Threonyl-L-glutamine is a crystalline compound with a molecular weight of approximately 308.34 g/m...

Compound Q&A

How is L-Threonyl-L-glutamine (CAS: 96337-79-0) typically synthesized?

L-Threonyl-L-glutamine is typically synthesized through solid-phase peptide synthesis (SPPS). The ke...

Compound Q&A

What precautions should be taken when handling L-Threonyl-L-glutamine (CAS: 96337-79-0)?

When handling L-Threonyl-L-glutamine, it is essential to wear appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...