Compound Q&A

What precautions should be taken when handling Azithromycin EP Impurity B (CAS: 307974-61-4)?

Answer

Azithromycin EP Impurity B (Azithromycin B)
When handling Azithromycin EP Impurity B (CAS: 307974-61-4), it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be managed quickly by using absorbent materials and following appropriate cleanup procedures. Always refer to the safety data sheet (SDS) for detailed instructions and emergency response measures. Storage should be in a cool, dry place, away from heat and direct sunlight.

About

English Name Azithromycin EP Impurity B (Azithromycin B)
Molecular Formula C38H72N2O11
Molecular Weight 733 g/mol
SMILES CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C)(O)C[C@@H](C)CN(C)[C@H](C)[C@@H](O)[C@H]1C
InChIKey JBYIGHZCRVMHAK-VINPOOLWSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Azithromycin EP Impurity B (CAS: 307974-61-4)?

Azithromycin EP Impurity B (CAS: 307974-61-4) is a crystalline compound with a molecular weight of a...

Compound Q&A

How is Azithromycin EP Impurity B (CAS: 307974-61-4) typically synthesized?

Azithromycin EP Impurity B (CAS: 307974-61-4) is synthesized through a complex route involving multi...

Compound Q&A

What industries use Azithromycin EP Impurity B (CAS: 307974-61-4)?

Azithromycin EP Impurity B (CAS: 307974-61-4) is primarily used in the pharmaceutical industry. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...