Compound Q&A

How is Azithromycin EP Impurity B (CAS: 307974-61-4) typically synthesized?

Answer

Azithromycin EP Impurity B (Azithromycin B)
Azithromycin EP Impurity B (CAS: 307974-61-4) is synthesized through a complex route involving multiple steps. Commonly, it is produced from azithromycin through a series of chemical transformations. The process involves selective hydrogenation, amidation, and other reactions, utilizing catalysts such as palladium on carbon. The overall yield is moderate, and the method is optimized for selectivity and purity. Detailed procedures and conditions are typically found in research literature and patent documents.

About

English Name Azithromycin EP Impurity B (Azithromycin B)
Molecular Formula C38H72N2O11
Molecular Weight 733 g/mol
SMILES CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C)(O)C[C@@H](C)CN(C)[C@H](C)[C@@H](O)[C@H]1C
InChIKey JBYIGHZCRVMHAK-VINPOOLWSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Azithromycin EP Impurity B (CAS: 307974-61-4)?

Azithromycin EP Impurity B (CAS: 307974-61-4) is a crystalline compound with a molecular weight of a...

Compound Q&A

What industries use Azithromycin EP Impurity B (CAS: 307974-61-4)?

Azithromycin EP Impurity B (CAS: 307974-61-4) is primarily used in the pharmaceutical industry. It s...

Compound Q&A

What precautions should be taken when handling Azithromycin EP Impurity B (CAS: 307974-61-4)?

When handling Azithromycin EP Impurity B (CAS: 307974-61-4), it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...