Compound Q&A

What are the physical and chemical properties of Azithromycin EP Impurity B (CAS: 307974-61-4)?

Answer

Azithromycin EP Impurity B (Azithromycin B)
Azithromycin EP Impurity B (CAS: 307974-61-4) is a crystalline compound with a molecular weight of approximately 801.86 g/mol. It has a solubility of about 10 mg/mL in water and is relatively stable under normal conditions. The compound shows limited reactivity, making it suitable for various pharmaceutical applications. It is soluble in organic solvents like methanol and ethanol but less so in non-polar solvents. It is important to handle the compound under appropriate conditions to avoid degradation.

About

English Name Azithromycin EP Impurity B (Azithromycin B)
Molecular Formula C38H72N2O11
Molecular Weight 733 g/mol
SMILES CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C)(O)C[C@@H](C)CN(C)[C@H](C)[C@@H](O)[C@H]1C
InChIKey JBYIGHZCRVMHAK-VINPOOLWSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

How is Azithromycin EP Impurity B (CAS: 307974-61-4) typically synthesized?

Azithromycin EP Impurity B (CAS: 307974-61-4) is synthesized through a complex route involving multi...

Compound Q&A

What industries use Azithromycin EP Impurity B (CAS: 307974-61-4)?

Azithromycin EP Impurity B (CAS: 307974-61-4) is primarily used in the pharmaceutical industry. It s...

Compound Q&A

What precautions should be taken when handling Azithromycin EP Impurity B (CAS: 307974-61-4)?

When handling Azithromycin EP Impurity B (CAS: 307974-61-4), it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...