Compound Q&A

What industries use Azithromycin EP Impurity B (CAS: 307974-61-4)?

Answer

Azithromycin EP Impurity B (Azithromycin B)
Azithromycin EP Impurity B (CAS: 307974-61-4) is primarily used in the pharmaceutical industry. It serves as a key component in the development and manufacturing of azithromycin-based medications. While it is not directly used in the production of polymers, sensors, or semiconductors, it plays a crucial role in ensuring the quality and purity of azithromycin formulations. Its presence is monitored during quality control checks to ensure the final product meets regulatory standards.

About

English Name Azithromycin EP Impurity B (Azithromycin B)
Molecular Formula C38H72N2O11
Molecular Weight 733 g/mol
SMILES CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C)(O)C[C@@H](C)CN(C)[C@H](C)[C@@H](O)[C@H]1C
InChIKey JBYIGHZCRVMHAK-VINPOOLWSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Azithromycin EP Impurity B (CAS: 307974-61-4)?

Azithromycin EP Impurity B (CAS: 307974-61-4) is a crystalline compound with a molecular weight of a...

Compound Q&A

How is Azithromycin EP Impurity B (CAS: 307974-61-4) typically synthesized?

Azithromycin EP Impurity B (CAS: 307974-61-4) is synthesized through a complex route involving multi...

Compound Q&A

What precautions should be taken when handling Azithromycin EP Impurity B (CAS: 307974-61-4)?

When handling Azithromycin EP Impurity B (CAS: 307974-61-4), it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...