Compound Q&A

What precautions should be taken when handling Folic Acid-d4 (CAS: 171777-72-3)?

Answer

Folic Acid-d4
When handling Folic Acid-d4 (CAS: 171777-72-3), it is essential to use personal protective equipment such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbent materials and the area should be ventilated. Always consult the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name Folic Acid-d4
Molecular Formula C19H19N7O6
Molecular Weight 445.43 g/mol
SMILES C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N
InChIKey OVBPIULPVIDEAO-ALIZGMTFSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Folic Acid-d4 (CAS: 171777-72-3)?

Folic Acid-d4 (CAS: 171777-72-3) is a crystalline derivative of folic acid. It has a molecular weigh...

Compound Q&A

How is Folic Acid-d4 (CAS: 171772-72-3) typically synthesized?

Folic Acid-d4 (CAS: 171777-72-3) is synthesized through the methylation of folic acid with dimethyl ...

Compound Q&A

What industries use Folic Acid-d4 (CAS: 171777-72-3)?

Folic Acid-d4 (CAS: 171777-72-3) is primarily used in pharmaceuticals for the synthesis of labeled c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...