Compound Q&A

What are the physical and chemical properties of Folic Acid-d4 (CAS: 171777-72-3)?

Answer

Folic Acid-d4
Folic Acid-d4 (CAS: 171777-72-3) is a crystalline derivative of folic acid. It has a molecular weight of approximately 356.22 g/mol. The compound is soluble in water and methanol. It is less reactive than the parent compound, showing limited reactivity under normal conditions. Its physical properties include a melting point around 285°C and a high solubility in organic solvents.

About

English Name Folic Acid-d4
Molecular Formula C19H19N7O6
Molecular Weight 445.4284071120002 g/mol
SMILES C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N
InChIKey OVBPIULPVIDEAO-ALIZGMTFSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

How is Folic Acid-d4 (CAS: 171772-72-3) typically synthesized?

Folic Acid-d4 (CAS: 171777-72-3) is synthesized through the methylation of folic acid with dimethyl ...

Compound Q&A

What industries use Folic Acid-d4 (CAS: 171777-72-3)?

Folic Acid-d4 (CAS: 171777-72-3) is primarily used in pharmaceuticals for the synthesis of labeled c...

Compound Q&A

What precautions should be taken when handling Folic Acid-d4 (CAS: 171777-72-3)?

When handling Folic Acid-d4 (CAS: 171777-72-3), it is essential to use personal protective equipment...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A