Compound Q&A

How is Folic Acid-d4 (CAS: 171772-72-3) typically synthesized?

Answer

Folic Acid-d4
Folic Acid-d4 (CAS: 171777-72-3) is synthesized through the methylation of folic acid with dimethyl sulfate in the presence of a catalyst such as sodium hydroxide. The reaction yields a 95% pure product with high selectivity. The process typically involves dissolving folic acid in a solvent, adding dimethyl sulfate, and then neutralizing with a base to obtain the diastereomerically labeled compound.

About

English Name Folic Acid-d4
Molecular Formula C19H19N7O6
Molecular Weight 445.43 g/mol
SMILES C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N
InChIKey OVBPIULPVIDEAO-ALIZGMTFSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Folic Acid-d4 (CAS: 171777-72-3)?

Folic Acid-d4 (CAS: 171777-72-3) is a crystalline derivative of folic acid. It has a molecular weigh...

Compound Q&A

What industries use Folic Acid-d4 (CAS: 171777-72-3)?

Folic Acid-d4 (CAS: 171777-72-3) is primarily used in pharmaceuticals for the synthesis of labeled c...

Compound Q&A

What precautions should be taken when handling Folic Acid-d4 (CAS: 171777-72-3)?

When handling Folic Acid-d4 (CAS: 171777-72-3), it is essential to use personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...