Compound Q&A

What industries use Folic Acid-d4 (CAS: 171777-72-3)?

Answer

Folic Acid-d4
Folic Acid-d4 (CAS: 171777-72-3) is primarily used in pharmaceuticals for the synthesis of labeled compounds for research and diagnostic purposes. It is also found in the chemical industry for the development of labeled biomolecules and in the academic and research sectors for studying metabolic pathways.

About

English Name Folic Acid-d4
Molecular Formula C19H19N7O6
Molecular Weight 445.4284071120002 g/mol
SMILES C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N
InChIKey OVBPIULPVIDEAO-ALIZGMTFSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Folic Acid-d4 (CAS: 171777-72-3)?

Folic Acid-d4 (CAS: 171777-72-3) is a crystalline derivative of folic acid. It has a molecular weigh...

Compound Q&A

How is Folic Acid-d4 (CAS: 171772-72-3) typically synthesized?

Folic Acid-d4 (CAS: 171777-72-3) is synthesized through the methylation of folic acid with dimethyl ...

Compound Q&A

What precautions should be taken when handling Folic Acid-d4 (CAS: 171777-72-3)?

When handling Folic Acid-d4 (CAS: 171777-72-3), it is essential to use personal protective equipment...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A