Compound Q&A

What industries use 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS: 124276-61-5)?

Answer

1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile
1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile is utilized in various industries, particularly in pharmaceuticals for medicinal chemistry and drug synthesis due to its unique chemical structure. It also finds applications in the polymer industry for synthesizing advanced polymers and in the electronics sector for producing semiconductor materials.

About

English Name 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile
Molecular Formula C11H8F3N
Molecular Weight 200.2 g/mol
SMILES FC(F)(F)c1ccc(cc1)C2(CC2)C#N
InChIKey WGLHDYUQTLHLHA-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS: 124276-61-5)?

1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile is a colorless to white crystalline solid with...

Compound Q&A

How is 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS: 124276-61-5) typically synthesized?

1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile is usually synthesized via a multistep process...

Compound Q&A

What precautions should be taken when handling 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS: 124276-61-5)?

When handling 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile, it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...