Compound Q&A

How is 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS: 124276-61-5) typically synthesized?

Answer

1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile
1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile is usually synthesized via a multistep process starting from 4-(trifluoromethyl)benzoyl chloride and cyclopropanecarbaldehyde. The synthesis involves nucleophilic addition followed by hydrolysis and nitrile formation, requiring careful control of reaction conditions to achieve high yield and selectivity.

About

English Name 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile
Molecular Formula C11H8F3N
Molecular Weight 200.2 g/mol
SMILES FC(F)(F)c1ccc(cc1)C2(CC2)C#N
InChIKey WGLHDYUQTLHLHA-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS: 124276-61-5)?

1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile is a colorless to white crystalline solid with...

Compound Q&A

What industries use 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS: 124276-61-5)?

1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile is utilized in various industries, particularl...

Compound Q&A

What precautions should be taken when handling 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS: 124276-61-5)?

When handling 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile, it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...