Compound Q&A

What are the physical and chemical properties of 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS: 124276-61-5)?

Answer

1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile
1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile is a colorless to white crystalline solid with a molecular weight of approximately 262.13 g/mol. It has low solubility in water but is soluble in common organic solvents like methanol and dichloromethane. The compound is known for its chemical stability and low reactivity under normal conditions, although it may undergo hydrolysis in the presence of moisture.

About

English Name 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile
Molecular Formula C11H8F3N
Molecular Weight 200.2 g/mol
SMILES FC(F)(F)c1ccc(cc1)C2(CC2)C#N
InChIKey WGLHDYUQTLHLHA-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

How is 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS: 124276-61-5) typically synthesized?

1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile is usually synthesized via a multistep process...

Compound Q&A

What industries use 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS: 124276-61-5)?

1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile is utilized in various industries, particularl...

Compound Q&A

What precautions should be taken when handling 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS: 124276-61-5)?

When handling 1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile, it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...