Compound Q&A

What precautions should be taken when handling 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0)?

Answer

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid
When handling 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid, it is important to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to prevent inhalation of vapors. Spills should be immediately cleaned up using appropriate absorbent materials. Always consult the Safety Data Sheet (SDS) for detailed handling and storage instructions.

About

English Name 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid
Molecular Formula C11H18FNO4
Molecular Weight 247.27 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C(C1)F)C(=O)O
InChIKey VAXFBQGBIHPZCF-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0)?

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid is a colorless crystalline solid with a...

Compound Q&A

How is 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0) typically synthesized?

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid is typically synthesized through a mult...

Compound Q&A

What industries use 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0)?

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid is primarily used in the pharmaceutical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...