Compound Q&A

How is 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0) typically synthesized?

Answer

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid
1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid is typically synthesized through a multi-step process involving the formation of a piperidine ring, followed by protection of the amine with tert-butoxycarbonyl (Boc) group, and subsequent introduction of the fluorine substituent. Commonly, this involves reactions like debenzylation, N-protectylation, and fluorination, with high selectivity and yield.

About

English Name 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid
Molecular Formula C11H18FNO4
Molecular Weight 247.27 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C(C1)F)C(=O)O
InChIKey VAXFBQGBIHPZCF-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0)?

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid is a colorless crystalline solid with a...

Compound Q&A

What industries use 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0)?

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0)?

When handling 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid, it is important to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...