Compound Q&A

What are the physical and chemical properties of 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0)?

Answer

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid
1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid is a colorless crystalline solid with a molecular weight of approximately 276.38 g/mol. It has a low solubility in water but is more soluble in organic solvents like DMSO and methanol. Chemically, it is highly reactive due to the presence of the carboxylic acid group and the fluorine substituent. It is prone to esterification and amidation reactions.

About

English Name 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid
Molecular Formula C11H18FNO4
Molecular Weight 247.27 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C(C1)F)C(=O)O
InChIKey VAXFBQGBIHPZCF-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0) typically synthesized?

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid is typically synthesized through a mult...

Compound Q&A

What industries use 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0)?

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0)?

When handling 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid, it is important to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...