Compound Q&A

What industries use 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0)?

Answer

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid
1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid is primarily used in the pharmaceutical industry for the synthesis of complex molecules and bioactive compounds. It may also find applications in polymer chemistry for developing novel materials and in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid
Molecular Formula C11H18FNO4
Molecular Weight 247.27 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C(C1)F)C(=O)O
InChIKey VAXFBQGBIHPZCF-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0)?

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid is a colorless crystalline solid with a...

Compound Q&A

How is 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0) typically synthesized?

1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid is typically synthesized through a mult...

Compound Q&A

What precautions should be taken when handling 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid (CAS: 1303974-46-0)?

When handling 1-(Tert-butoxycarbonyl)-3-fluoropiperidine-4-carboxylic acid, it is important to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...