Compound Q&A

What precautions should be taken when handling (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-5 (CAS: 125-73-5)?

Answer

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol
When handling (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate disposal methods, and safety data sheets (SDS) should be consulted for detailed handling and disposal instructions.

About

CAS No 125-73-5
English Name (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol
Molecular Formula C17H23NO
Molecular Weight 257.38 g/mol
SMILES CN1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc4c3cc(cc4)O
InChIKey JAQUASYNZVUNQP-PVAVHDDUSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5)?

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol is a crystalline compound with a molecular weight o...

Compound Q&A

How is (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5) typically synthesized?

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol is often synthesized via a multi-step process start...

Compound Q&A

What industries use (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5)?

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol is primarily used in the pharmaceutical industry fo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...