Compound Q&A

What are the physical and chemical properties of (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5)?

Answer

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol
(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol is a crystalline compound with a molecular weight of approximately 283.41 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol. This compound exhibits moderate reactivity, particularly in acidic environments. It is stable under normal conditions but can degrade upon prolonged exposure to light.

About

CAS No 125-73-5
English Name (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol
Molecular Formula C17H23NO
Molecular Weight 257.38 g/mol
SMILES CN1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc4c3cc(cc4)O
InChIKey JAQUASYNZVUNQP-PVAVHDDUSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

How is (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5) typically synthesized?

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol is often synthesized via a multi-step process start...

Compound Q&A

What industries use (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5)?

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol is primarily used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-5 (CAS: 125-73-5)?

When handling (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5), it is essential to u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...