Compound Q&A

What industries use (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5)?

Answer

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol
(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol is primarily used in the pharmaceutical industry for the development of analgesic medications. It can also find applications in the research and development of new drugs for pain management and addiction treatment. This compound is also utilized in some specialized medical and chemical industries due to its unique properties.

About

CAS No 125-73-5
English Name (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol
Molecular Formula C17H23NO
Molecular Weight 257.38 g/mol
SMILES CN1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc4c3cc(cc4)O
InChIKey JAQUASYNZVUNQP-PVAVHDDUSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5)?

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol is a crystalline compound with a molecular weight o...

Compound Q&A

How is (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5) typically synthesized?

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol is often synthesized via a multi-step process start...

Compound Q&A

What precautions should be taken when handling (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-5 (CAS: 125-73-5)?

When handling (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5), it is essential to u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...