Compound Q&A

How is (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5) typically synthesized?

Answer

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol
(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol is often synthesized via a multi-step process starting from morphine or its precursors. The key steps involve ring closure and methylation reactions. This compound can be synthesized using various catalysts and reagents to achieve high selectivity and yield, making it suitable for pharmaceutical applications.

About

CAS No 125-73-5
English Name (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol
Molecular Formula C17H23NO
Molecular Weight 257.38 g/mol
SMILES CN1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc4c3cc(cc4)O
InChIKey JAQUASYNZVUNQP-PVAVHDDUSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5)?

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol is a crystalline compound with a molecular weight o...

Compound Q&A

What industries use (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5)?

(9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol is primarily used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-5 (CAS: 125-73-5)?

When handling (9alpha,13alpha,14alpha)-17-Methylmorphinan-3-ol (CAS: 125-73-5), it is essential to u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...