Compound Q&A

What precautions should be taken when handling 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3)?

Answer

3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine
When handling 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine, appropriate personal protective equipment (PPE) should be worn, including gloves, goggles, and a lab coat. This compound should be used in a well-ventilated area or in a fume hood due to its potential volatility and reactivity. Spills should be cleaned up immediately with appropriate absorbent materials, and the area should be thoroughly cleaned. Safety data sheets (SDS) should be consulted for detailed emergency procedures and storage guidelines.

About

English Name 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine
Molecular Formula C24H21ClN2O7
Molecular Weight 484.89 g/mol
SMILES C[C@]1([C@@H]([C@H](O[C@H]1n2ccc(=O)[nH]c2=O)COC(=O)c3ccccc3)OC(=O)c4ccccc4)Cl
InChIKey QUSIDKWVBPQGDG-PDKZGUECSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3)?

The compound 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine is a crystalline solid with a mo...

Compound Q&A

How is 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3) typically synthesized?

3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine is typically synthesized through a multi-step...

Compound Q&A

What industries use 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3)?

3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine is primarily used in the pharmaceutical indus...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...