Compound Q&A

What are the physical and chemical properties of 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3)?

Answer

3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine
The compound 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine is a crystalline solid with a molecular weight of approximately 500.52 g/mol. It has a low solubility in water but is more soluble in organic solvents such as methanol and acetonitrile. The compound is known for its high reactivity towards nucleophilic substitution, particularly due to the presence of the chloromethyl group.

About

English Name 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine
Molecular Formula C24H21ClN2O7
Molecular Weight 484.89 g/mol
SMILES C[C@]1([C@@H]([C@H](O[C@H]1n2ccc(=O)[nH]c2=O)COC(=O)c3ccccc3)OC(=O)c4ccccc4)Cl
InChIKey QUSIDKWVBPQGDG-PDKZGUECSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

How is 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3) typically synthesized?

3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine is typically synthesized through a multi-step...

Compound Q&A

What industries use 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3)?

3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3)?

When handling 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine, appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...