Compound Q&A

What industries use 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3)?

Answer

3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine
3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine is primarily used in the pharmaceutical industry for its potential as an antiviral agent. It is also of interest in research applications for its structural and reactive properties, making it relevant to fields such as polymer chemistry and sensor technology.

About

English Name 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine
Molecular Formula C24H21ClN2O7
Molecular Weight 484.89 g/mol
SMILES C[C@]1([C@@H]([C@H](O[C@H]1n2ccc(=O)[nH]c2=O)COC(=O)c3ccccc3)OC(=O)c4ccccc4)Cl
InChIKey QUSIDKWVBPQGDG-PDKZGUECSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3)?

The compound 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine is a crystalline solid with a mo...

Compound Q&A

How is 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3) typically synthesized?

3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine is typically synthesized through a multi-step...

Compound Q&A

What precautions should be taken when handling 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3)?

When handling 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine, appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...