Compound Q&A

How is 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3) typically synthesized?

Answer

3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine
3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine is typically synthesized through a multi-step process, starting with the benzoylation of uridine followed by the introduction of a chloromethyl group. The synthesis involves the use of acylating agents and chlorinating reagents, and the overall process yields the desired product with good selectivity and moderate to high yield.

About

English Name 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine
Molecular Formula C24H21ClN2O7
Molecular Weight 484.89 g/mol
SMILES C[C@]1([C@@H]([C@H](O[C@H]1n2ccc(=O)[nH]c2=O)COC(=O)c3ccccc3)OC(=O)c4ccccc4)Cl
InChIKey QUSIDKWVBPQGDG-PDKZGUECSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3)?

The compound 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine is a crystalline solid with a mo...

Compound Q&A

What industries use 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3)?

3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine (CAS: 1496551-71-3)?

When handling 3',5'-Di-O-benzoyl-2'-chloro-2'-deoxy-2'-methyluridine, appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...