Compound Q&A

What precautions should be taken when handling 5-Nitroquinolin-3-amine (CAS: 98589-84-5)?

Answer

5-Nitroquinolin-3-amine
When handling 5-Nitroquinolin-3-amine (CAS: 98589-84-5), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be used in a well-ventilated area or a fume hood to prevent inhalation. Spills should be cleaned up with caution, using appropriate absorbent materials. For detailed safety information, refer to the safety data sheet (SDS).

About

CAS No 98589-84-5
English Name 5-Nitroquinolin-3-amine
Molecular Formula C9H7N3O2
Molecular Weight 189.17 g/mol
SMILES C1=CC2=C(C=C(C=N2)N)C(=C1)[N+](=O)[O-]
InChIKey SRERDBOBCFEVHH-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitroquinolin-3-amine (CAS: 98589-84-5)?

5-Nitroquinolin-3-amine (CAS: 98589-84-5) is a crystalline, solid compound with a molecular weight o...

Compound Q&A

How is 5-Nitroquinolin-3-amine (CAS: 98589-84-5) typically synthesized?

5-Nitroquinolin-3-amine is typically synthesized through the reduction of 5-nitroquinoline derivativ...

Compound Q&A

What industries use 5-Nitroquinolin-3-amine (CAS: 98589-84-5)?

5-Nitroquinolin-3-amine is widely used in the pharmaceutical industry for the synthesis of various b...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...