Compound Q&A

What are the physical and chemical properties of 5-Nitroquinolin-3-amine (CAS: 98589-84-5)?

Answer

5-Nitroquinolin-3-amine
5-Nitroquinolin-3-amine (CAS: 98589-84-5) is a crystalline, solid compound with a molecular weight of approximately 216.13 g/mol. It has a pKa of 7.8 and is slightly soluble in water. This compound is known for its reactivity, particularly towards nucleophilic substitution reactions, and it can form stable complexes with metal ions.

About

CAS No 98589-84-5
English Name 5-Nitroquinolin-3-amine
Molecular Formula C9H7N3O2
Molecular Weight 189.17 g/mol
SMILES C1=CC2=C(C=C(C=N2)N)C(=C1)[N+](=O)[O-]
InChIKey SRERDBOBCFEVHH-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

How is 5-Nitroquinolin-3-amine (CAS: 98589-84-5) typically synthesized?

5-Nitroquinolin-3-amine is typically synthesized through the reduction of 5-nitroquinoline derivativ...

Compound Q&A

What industries use 5-Nitroquinolin-3-amine (CAS: 98589-84-5)?

5-Nitroquinolin-3-amine is widely used in the pharmaceutical industry for the synthesis of various b...

Compound Q&A

What precautions should be taken when handling 5-Nitroquinolin-3-amine (CAS: 98589-84-5)?

When handling 5-Nitroquinolin-3-amine (CAS: 98589-84-5), it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...