Compound Q&A

How is 5-Nitroquinolin-3-amine (CAS: 98589-84-5) typically synthesized?

Answer

5-Nitroquinolin-3-amine
5-Nitroquinolin-3-amine is typically synthesized through the reduction of 5-nitroquinoline derivatives using hydrazine hydrate. The reaction proceeds through a condensation followed by an amination step, yielding high selectivity and good yield. Catalysts such as palladium or copper can be employed to enhance the reaction efficiency.

About

CAS No 98589-84-5
English Name 5-Nitroquinolin-3-amine
Molecular Formula C9H7N3O2
Molecular Weight 189.17 g/mol
SMILES C1=CC2=C(C=C(C=N2)N)C(=C1)[N+](=O)[O-]
InChIKey SRERDBOBCFEVHH-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitroquinolin-3-amine (CAS: 98589-84-5)?

5-Nitroquinolin-3-amine (CAS: 98589-84-5) is a crystalline, solid compound with a molecular weight o...

Compound Q&A

What industries use 5-Nitroquinolin-3-amine (CAS: 98589-84-5)?

5-Nitroquinolin-3-amine is widely used in the pharmaceutical industry for the synthesis of various b...

Compound Q&A

What precautions should be taken when handling 5-Nitroquinolin-3-amine (CAS: 98589-84-5)?

When handling 5-Nitroquinolin-3-amine (CAS: 98589-84-5), it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...