Compound Q&A

What industries use 5-Nitroquinolin-3-amine (CAS: 98589-84-5)?

Answer

5-Nitroquinolin-3-amine
5-Nitroquinolin-3-amine is widely used in the pharmaceutical industry for the synthesis of various bioactive compounds. It is also utilized in the polymer industry for the modification of polymer properties and in semiconductor manufacturing for doping processes. Additionally, it has applications in sensor technology due to its ability to form stable complexes with metal ions.

About

CAS No 98589-84-5
English Name 5-Nitroquinolin-3-amine
Molecular Formula C9H7N3O2
Molecular Weight 189.17 g/mol
SMILES C1=CC2=C(C=C(C=N2)N)C(=C1)[N+](=O)[O-]
InChIKey SRERDBOBCFEVHH-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitroquinolin-3-amine (CAS: 98589-84-5)?

5-Nitroquinolin-3-amine (CAS: 98589-84-5) is a crystalline, solid compound with a molecular weight o...

Compound Q&A

How is 5-Nitroquinolin-3-amine (CAS: 98589-84-5) typically synthesized?

5-Nitroquinolin-3-amine is typically synthesized through the reduction of 5-nitroquinoline derivativ...

Compound Q&A

What precautions should be taken when handling 5-Nitroquinolin-3-amine (CAS: 98589-84-5)?

When handling 5-Nitroquinolin-3-amine (CAS: 98589-84-5), it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...