Compound Q&A

What precautions should be taken when handling 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0)?

Answer

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide
When handling 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0), it is essential to use appropriate personal protective equipment (PPE) such as gloves and goggles. Work should be conducted in a well-ventilated area or under a fume hood to minimize exposure to the compound. In case of a spill, use appropriate spill response materials and avoid contact with skin or eyes. Always consult the Safety Data Sheet (SDS) for detailed handling and storage information.

About

CAS No 82222-74-0
English Name 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide
Molecular Formula C10H12ClNO2S
Molecular Weight 245.73 g/mol
SMILES C1CS(=O)(=O)CCN1C2=CC=C(C=C2)Cl
InChIKey IQIXFXLKPNFQGQ-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0)?

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0) is a crystalline compound with a mole...

Compound Q&A

How is 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0) typically synthesized?

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide is typically synthesized through the condensation of 4-...

Compound Q&A

What industries use 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0)?

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0) is used in various industries due to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...