Compound Q&A

What industries use 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0)?

Answer

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide
4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0) is used in various industries due to its unique chemical properties. It is particularly valuable in pharmaceuticals for the synthesis of certain drugs, in polymer science for developing specialized materials, and in the production of sensors and semiconductors where its functional groups can be utilized for specific applications.

About

CAS No 82222-74-0
English Name 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide
Molecular Formula C10H12ClNO2S
Molecular Weight 245.73 g/mol
SMILES C1CS(=O)(=O)CCN1C2=CC=C(C=C2)Cl
InChIKey IQIXFXLKPNFQGQ-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0)?

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0) is a crystalline compound with a mole...

Compound Q&A

How is 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0) typically synthesized?

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide is typically synthesized through the condensation of 4-...

Compound Q&A

What precautions should be taken when handling 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0)?

When handling 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0), it is essential to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...