Compound Q&A

How is 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0) typically synthesized?

Answer

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide
4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide is typically synthesized through the condensation of 4-chlorophenyl isothiocyanate with morpholine. Commonly, this reaction is conducted in the presence of a base like triethylamine to promote the formation of the desired product. The reaction yield can be improved by using catalysts and optimizing reaction conditions such as temperature and solvent choice.

About

CAS No 82222-74-0
English Name 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide
Molecular Formula C10H12ClNO2S
Molecular Weight 245.73 g/mol
SMILES C1CS(=O)(=O)CCN1C2=CC=C(C=C2)Cl
InChIKey IQIXFXLKPNFQGQ-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0)?

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0) is a crystalline compound with a mole...

Compound Q&A

What industries use 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0)?

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0) is used in various industries due to ...

Compound Q&A

What precautions should be taken when handling 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0)?

When handling 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0), it is essential to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...