Compound Q&A

What are the physical and chemical properties of 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0)?

Answer

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide
4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0) is a crystalline compound with a molecular weight of approximately 243.01 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and ethanol. The compound is reactive, particularly towards nucleophiles and bases, making it suitable for various chemical transformations. It features a thiomorpholine ring with a chlorophenyl substituent, which influences its reactivity and solubility properties.

About

CAS No 82222-74-0
English Name 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide
Molecular Formula C10H12ClNO2S
Molecular Weight 245.73 g/mol
SMILES C1CS(=O)(=O)CCN1C2=CC=C(C=C2)Cl
InChIKey IQIXFXLKPNFQGQ-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0) typically synthesized?

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide is typically synthesized through the condensation of 4-...

Compound Q&A

What industries use 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0)?

4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0) is used in various industries due to ...

Compound Q&A

What precautions should be taken when handling 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0)?

When handling 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide (CAS: 82222-74-0), it is essential to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...