Compound Q&A

What industries use (2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide (CAS: 2226521-65-7)?

Answer

(2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide
This compound is primarily used in the pharmaceutical industry for its potential as an intermediate in the synthesis of novel drugs. It also finds applications in the polymer industry for its ability to form stable acrylamide-based polymers. Additionally, it has potential uses in sensor technology due to its chemical reactivity and stability.

About

English Name (2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide
Molecular Formula C24H24N6O2
Molecular Weight 428.49 g/mol
SMILES N#C/C(=C\c1ccc(o1)c1nc2c(n1C1CCCCC1)c1cc[nH]c1nc2)/C(=O)N(C)C
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is (2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide (CAS: 2226521-65-7) typically synthesized?

This compound is synthesized via a multistep process involving the condensation of a cyclohexyl-1,6-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...